C27H33Cl2N3O4 — CID 99751359
(1S,2S,5R,6S,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-(3-methylbutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99751359) has the molecular formula C27H33Cl2N3O4 and a molecular weight of 534.48 g/mol. Its IUPAC name is (1S,2S,5R,6S,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-(3-methylbutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2S,5R,6S,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-(3-methylbutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99751359 |
| Molecular Formula | C27H33Cl2N3O4 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (1S,2S,5R,6S,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-(3-methylbutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)CCN1C(=O)[C@@H]2[C@H](C(=O)Nc3cc(Cl)cc(Cl)c3)[C@@H]3C=C[C@@]2(O3)[C@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C27H33Cl2N3O4/c1-15(2)9-11-32-23(25(34)30-18-6-4-3-5-7-18)27-10-8-20(36-27)21(22(27)26(32)35)24(33)31-19-13-16(28)12-17(29)14-19/h8,10,12-15,18,20-23H,3-7,9,11H2,1-2H3,(H,30,34)(H,31,33)/t20-,21+,22-,23+,27-/m0/s1 |
| InChIKey | YMVQXAQIWSXHJV-ZUJRCILVSA-N |
| XLogP | 4.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|