C27H27Cl2N3O4S — CID 87049134
(5R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049134) has the molecular formula C27H27Cl2N3O4S and a molecular weight of 560.50 g/mol. Its IUPAC name is (5R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049134 |
| Molecular Formula | C27H27Cl2N3O4S |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | (5R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-4-oxo-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C1[C@@H]2C=CC3(O2)C(C(=O)NC2CCCCC2)N(Cc2cccs2)C(=O)[C@H]13 |
| InChI | InChI=1S/C27H27Cl2N3O4S/c28-15-11-16(29)13-18(12-15)31-24(33)21-20-8-9-27(36-20)22(21)26(35)32(14-19-7-4-10-37-19)23(27)25(34)30-17-5-2-1-3-6-17/h4,7-13,17,20-23H,1-3,5-6,14H2,(H,30,34)(H,31,33)/t20-,21?,22-,23?,27?/m0/s1 |
| InChIKey | LYURKQNKMLRBPM-XCLLSHAVSA-N |
| XLogP | 4.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|