C29H28Cl2FN3O4 — CID 98179940
(1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[(2-fluorophenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98179940) has the molecular formula C29H28Cl2FN3O4 and a molecular weight of 572.46 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[(2-fluorophenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[(2-fluorophenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98179940 |
| Molecular Formula | C29H28Cl2FN3O4 |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,5-dichlorophenyl)-3-[(2-fluorophenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)[C@H]1[C@@H]2C=C[C@]3(O2)[C@@H]1C(=O)N(Cc1ccccc1F)[C@H]3C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C29H28Cl2FN3O4/c30-17-12-18(31)14-20(13-17)34-26(36)23-22-10-11-29(39-22)24(23)28(38)35(15-16-6-4-5-9-21(16)32)25(29)27(37)33-19-7-2-1-3-8-19/h4-6,9-14,19,22-25H,1-3,7-8,15H2,(H,33,37)(H,34,36)/t22-,23-,24-,25-,29-/m0/s1 |
| InChIKey | IQWDWXJLXZNNEN-GLXJOHRYSA-N |
| XLogP | 4.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|