C30H31Cl2N3O4 — CID 99748259
(1S,2R,5R,6R,7S)-6-N-(3-chloro-4-methylphenyl)-3-[(2-chlorophenyl)methyl]-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99748259) has the molecular formula C30H31Cl2N3O4 and a molecular weight of 568.50 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-6-N-(3-chloro-4-methylphenyl)-3-[(2-chlorophenyl)methyl]-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-6-N-(3-chloro-4-methylphenyl)-3-[(2-chlorophenyl)methyl]-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99748259 |
| Molecular Formula | C30H31Cl2N3O4 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | (1S,2R,5R,6R,7S)-6-N-(3-chloro-4-methylphenyl)-3-[(2-chlorophenyl)methyl]-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N(Cc2ccccc2Cl)[C@H]4C(=O)NC2CCCCC2)cc1Cl |
| InChI | InChI=1S/C30H31Cl2N3O4/c1-17-11-12-20(15-22(17)32)34-27(36)24-23-13-14-30(39-23)25(24)29(38)35(16-18-7-5-6-10-21(18)31)26(30)28(37)33-19-8-3-2-4-9-19/h5-7,10-15,19,23-26H,2-4,8-9,16H2,1H3,(H,33,37)(H,34,36)/t23-,24-,25-,26-,30-/m0/s1 |
| InChIKey | CFVMGNLCXQDIJU-WZFWIWBTSA-N |
| XLogP | 5.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|