C31H41ClN4O4 — CID 164631434
(1R,5R,7S)-3-[2-(azepan-1-yl)ethyl]-6-N-(3-chloro-4-methylphenyl)-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 164631434) has the molecular formula C31H41ClN4O4 and a molecular weight of 569.15 g/mol. Its IUPAC name is (1R,5R,7S)-3-[2-(azepan-1-yl)ethyl]-6-N-(3-chloro-4-methylphenyl)-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,5R,7S)-3-[2-(azepan-1-yl)ethyl]-6-N-(3-chloro-4-methylphenyl)-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 164631434 |
| Molecular Formula | C31H41ClN4O4 |
| Molecular Weight | 569.15 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | (1R,5R,7S)-3-[2-(azepan-1-yl)ethyl]-6-N-(3-chloro-4-methylphenyl)-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2[C@@H]3C=C[C@]4(O3)C(C(=O)NC3CCCCC3)N(CCN3CCCCCC3)C(=O)[C@H]24)cc1Cl |
| InChI | InChI=1S/C31H41ClN4O4/c1-20-11-12-22(19-23(20)32)34-28(37)25-24-13-14-31(40-24)26(25)30(39)36(18-17-35-15-7-2-3-8-16-35)27(31)29(38)33-21-9-5-4-6-10-21/h11-14,19,21,24-27H,2-10,15-18H2,1H3,(H,33,38)(H,34,37)/t24-,25?,26-,27?,31+/m0/s1 |
| InChIKey | PHLCUMQOABULBA-ORTGXWGFSA-N |
| XLogP | 4.06 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|