C35H44N4O4 — CID 99756427
(1R,2R,5S,6S,7R)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99756427) has the molecular formula C35H44N4O4 and a molecular weight of 584.76 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6S,7R)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99756427 |
| Molecular Formula | C35H44N4O4 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | (1R,2R,5S,6S,7R)-3-[2-[benzyl(methyl)amino]ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@@H]2[C@H]3C=C[C@]4(O3)[C@H](C(=O)NC3CCCCC3)N(CCN(C)Cc3ccccc3)C(=O)[C@@H]24)cc1 |
| InChI | InChI=1S/C35H44N4O4/c1-23(2)25-14-16-27(17-15-25)36-32(40)29-28-18-19-35(43-28)30(29)34(42)39(21-20-38(3)22-24-10-6-4-7-11-24)31(35)33(41)37-26-12-8-5-9-13-26/h4,6-7,10-11,14-19,23,26,28-31H,5,8-9,12-13,20-22H2,1-3H3,(H,36,40)(H,37,41)/t28-,29-,30-,31+,35-/m1/s1 |
| InChIKey | KHNUEHBYBJVGHY-CLKWDTPPSA-N |
| XLogP | 4.48 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|