C33H38ClN3O4 — CID 98181505
(1R,2S,5S,6S,7R)-3-[2-(2-chlorophenyl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98181505) has the molecular formula C33H38ClN3O4 and a molecular weight of 576.14 g/mol. Its IUPAC name is (1R,2S,5S,6S,7R)-3-[2-(2-chlorophenyl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6S,7R)-3-[2-(2-chlorophenyl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98181505 |
| Molecular Formula | C33H38ClN3O4 |
| Molecular Weight | 576.14 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | (1R,2S,5S,6S,7R)-3-[2-(2-chlorophenyl)ethyl]-2-N-cyclohexyl-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(CCc2ccccc2Cl)[C@@H]4C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C33H38ClN3O4/c1-20(2)21-12-14-24(15-13-21)35-30(38)27-26-16-18-33(41-26)28(27)32(40)37(19-17-22-8-6-7-11-25(22)34)29(33)31(39)36-23-9-4-3-5-10-23/h6-8,11-16,18,20,23,26-29H,3-5,9-10,17,19H2,1-2H3,(H,35,38)(H,36,39)/t26-,27-,28-,29-,33-/m1/s1 |
| InChIKey | WBAKYNPQHBDINY-RCXZSUCBSA-N |
| XLogP | 5.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.14 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|