C35H34FN3O5 — CID 99753172
(1R,2R,5S,6R,7R)-2-N-cyclohexyl-3-[(4-fluorophenyl)methyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99753172) has the molecular formula C35H34FN3O5 and a molecular weight of 595.67 g/mol. Its IUPAC name is (1R,2R,5S,6R,7R)-2-N-cyclohexyl-3-[(4-fluorophenyl)methyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6R,7R)-2-N-cyclohexyl-3-[(4-fluorophenyl)methyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99753172 |
| Molecular Formula | C35H34FN3O5 |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (1R,2R,5S,6R,7R)-2-N-cyclohexyl-3-[(4-fluorophenyl)methyl]-4-oxo-6-N-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)[C@H]1[C@H]2C=C[C@]3(O2)[C@H](C(=O)NC2CCCCC2)N(Cc2ccc(F)cc2)C(=O)[C@@H]13 |
| InChI | InChI=1S/C35H34FN3O5/c36-23-13-11-22(12-14-23)21-39-31(33(41)38-24-7-3-1-4-8-24)35-20-19-28(44-35)29(30(35)34(39)42)32(40)37-25-15-17-27(18-16-25)43-26-9-5-2-6-10-26/h2,5-6,9-20,24,28-31H,1,3-4,7-8,21H2,(H,37,40)(H,38,41)/t28-,29+,30-,31+,35-/m1/s1 |
| InChIKey | ODGKGRADWMHBSW-UICYFZHZSA-N |
| XLogP | 5.36 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|