C29H29BrFN3O4 — CID 99748357
(1R,2R,5S,6S,7R)-6-N-(4-bromophenyl)-2-N-cyclohexyl-3-[(4-fluorophenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99748357) has the molecular formula C29H29BrFN3O4 and a molecular weight of 582.47 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-6-N-(4-bromophenyl)-2-N-cyclohexyl-3-[(4-fluorophenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6S,7R)-6-N-(4-bromophenyl)-2-N-cyclohexyl-3-[(4-fluorophenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99748357 |
| Molecular Formula | C29H29BrFN3O4 |
| Molecular Weight | 582.47 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | (1R,2R,5S,6S,7R)-6-N-(4-bromophenyl)-2-N-cyclohexyl-3-[(4-fluorophenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)[C@@H]1[C@H]2C=C[C@]3(O2)[C@H](C(=O)NC2CCCCC2)N(Cc2ccc(F)cc2)C(=O)[C@@H]13 |
| InChI | InChI=1S/C29H29BrFN3O4/c30-18-8-12-21(13-9-18)32-26(35)23-22-14-15-29(38-22)24(23)28(37)34(16-17-6-10-19(31)11-7-17)25(29)27(36)33-20-4-2-1-3-5-20/h6-15,20,22-25H,1-5,16H2,(H,32,35)(H,33,36)/t22-,23-,24-,25+,29-/m1/s1 |
| InChIKey | AMBKXPQHJXTULR-VYTDYDGLSA-N |
| XLogP | 4.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|