C31H35N3O4S — CID 99749117
(1R,2S,5S,6R,7R)-2-N-cyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-3-[(1S)-1-phenylethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99749117) has the molecular formula C31H35N3O4S and a molecular weight of 545.71 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-2-N-cyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-3-[(1S)-1-phenylethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6R,7R)-2-N-cyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-3-[(1S)-1-phenylethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99749117 |
| Molecular Formula | C31H35N3O4S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | (1R,2S,5S,6R,7R)-2-N-cyclohexyl-6-N-(3-methylsulfanylphenyl)-4-oxo-3-[(1S)-1-phenylethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CSc1cccc(NC(=O)[C@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N([C@@H](C)c2ccccc2)[C@@H]4C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C31H35N3O4S/c1-19(20-10-5-3-6-11-20)34-27(29(36)32-21-12-7-4-8-13-21)31-17-16-24(38-31)25(26(31)30(34)37)28(35)33-22-14-9-15-23(18-22)39-2/h3,5-6,9-11,14-19,21,24-27H,4,7-8,12-13H2,1-2H3,(H,32,36)(H,33,35)/t19-,24+,25-,26+,27+,31+/m0/s1 |
| InChIKey | JGWLRIQGLZXBMC-HIJGWZOPSA-N |
| XLogP | 4.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|