C26H32ClN3O4 — CID 87049308
(5S,7R)-3-butan-2-yl-6-N-(4-chlorophenyl)-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049308) has the molecular formula C26H32ClN3O4 and a molecular weight of 486.01 g/mol. Its IUPAC name is (5S,7R)-3-butan-2-yl-6-N-(4-chlorophenyl)-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-3-butan-2-yl-6-N-(4-chlorophenyl)-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049308 |
| Molecular Formula | C26H32ClN3O4 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | (5S,7R)-3-butan-2-yl-6-N-(4-chlorophenyl)-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCC(C)N1C(=O)[C@H]2C(C(=O)Nc3ccc(Cl)cc3)[C@H]3C=CC2(O3)C1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C26H32ClN3O4/c1-3-15(2)30-22(24(32)29-17-7-5-4-6-8-17)26-14-13-19(34-26)20(21(26)25(30)33)23(31)28-18-11-9-16(27)10-12-18/h9-15,17,19-22H,3-8H2,1-2H3,(H,28,31)(H,29,32)/t15?,19-,20?,21-,22?,26?/m1/s1 |
| InChIKey | IIAIONQBVJEUJH-YQAOGLHESA-N |
| XLogP | 3.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|