C38H41N3O5 — CID 87049399
(5S,7R)-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-3-(4-phenylbutan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049399) has the molecular formula C38H41N3O5 and a molecular weight of 619.76 g/mol. Its IUPAC name is (5S,7R)-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-3-(4-phenylbutan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-3-(4-phenylbutan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049399 |
| Molecular Formula | C38H41N3O5 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | (5S,7R)-2-N-cyclohexyl-4-oxo-6-N-(4-phenoxyphenyl)-3-(4-phenylbutan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(CCc1ccccc1)N1C(=O)[C@H]2C(C(=O)Nc3ccc(Oc4ccccc4)cc3)[C@H]3C=CC2(O3)C1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C38H41N3O5/c1-25(17-18-26-11-5-2-6-12-26)41-34(36(43)40-27-13-7-3-8-14-27)38-24-23-31(46-38)32(33(38)37(41)44)35(42)39-28-19-21-30(22-20-28)45-29-15-9-4-10-16-29/h2,4-6,9-12,15-16,19-25,27,31-34H,3,7-8,13-14,17-18H2,1H3,(H,39,42)(H,40,43)/t25?,31-,32?,33-,34?,38?/m1/s1 |
| InChIKey | TZRFBCNLLRFISO-AALQRLPDSA-N |
| XLogP | 6.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|