C14H28N2O — CID 87053295
(3R,4R)-1-butyl-4-methyl-3-pyrrolidin-1-ylpiperidin-4-ol (PubChem CID 87053295) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is (3R,4R)-1-butyl-4-methyl-3-pyrrolidin-1-ylpiperidin-4-ol.
| Compound Name | (3R,4R)-1-butyl-4-methyl-3-pyrrolidin-1-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 87053295 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | (3R,4R)-1-butyl-4-methyl-3-pyrrolidin-1-ylpiperidin-4-ol |
| SMILES | CCCCN1CC[C@@](C)(O)[C@H](N2CCCC2)C1 |
| InChI | InChI=1S/C14H28N2O/c1-3-4-8-15-11-7-14(2,17)13(12-15)16-9-5-6-10-16/h13,17H,3-12H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | VSQWKGLFIGLMHD-ZIAGYGMSSA-N |
| XLogP | 1.71 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |