C13H25F2NO — CID 138581107
4,4-difluoro-1-octylpiperidin-3-ol (PubChem CID 138581107) has the molecular formula C13H25F2NO and a molecular weight of 249.34 g/mol. Its IUPAC name is 4,4-difluoro-1-octylpiperidin-3-ol.
| Compound Name | 4,4-difluoro-1-octylpiperidin-3-ol |
|---|---|
| PubChem CID | 138581107 |
| Molecular Formula | C13H25F2NO |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 4,4-difluoro-1-octylpiperidin-3-ol |
| SMILES | CCCCCCCCN1CCC(F)(F)C(O)C1 |
| InChI | InChI=1S/C13H25F2NO/c1-2-3-4-5-6-7-9-16-10-8-13(14,15)12(17)11-16/h12,17H,2-11H2,1H3 |
| InChIKey | OOWWGYMYTMKTEB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|