C21H21BrN4O2 — CID 87053955
6-(4-bromophenyl)-N-(3-phenylpropyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxamide (PubChem CID 87053955) has the molecular formula C21H21BrN4O2 and a molecular weight of 441.33 g/mol. Its IUPAC name is 6-(4-bromophenyl)-N-(3-phenylpropyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxamide.
| Compound Name | 6-(4-bromophenyl)-N-(3-phenylpropyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxamide |
|---|---|
| PubChem CID | 87053955 |
| Molecular Formula | C21H21BrN4O2 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 6-(4-bromophenyl)-N-(3-phenylpropyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1nnn2c1COC(c1ccc(Br)cc1)C2 |
| InChI | InChI=1S/C21H21BrN4O2/c22-17-10-8-16(9-11-17)19-13-26-18(14-28-19)20(24-25-26)21(27)23-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,19H,4,7,12-14H2,(H,23,27) |
| InChIKey | PZJGFXYIJMWQLO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|