C16H25N3O4 — CID 87054491
1-(2-methoxyethyl)-5-[[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]methyl]pyridin-2-one (PubChem CID 87054491) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-[[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]methyl]pyridin-2-one.
| Compound Name | 1-(2-methoxyethyl)-5-[[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 87054491 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(2-methoxyethyl)-5-[[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]methyl]pyridin-2-one |
| SMILES | COCCn1cc(CN(C)CC(=O)N2CCOCC2)ccc1=O |
| InChI | InChI=1S/C16H25N3O4/c1-17(13-16(21)18-6-9-23-10-7-18)11-14-3-4-15(20)19(12-14)5-8-22-2/h3-4,12H,5-11,13H2,1-2H3 |
| InChIKey | MDKRLQCUVWXHSN-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |