C20H21F2NO3 — CID 87055318
4-[4-[3-(cyclobutylamino)phenyl]-2,6-difluorophenoxy]butanoic acid (PubChem CID 87055318) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is 4-[4-[3-(cyclobutylamino)phenyl]-2,6-difluorophenoxy]butanoic acid.
| Compound Name | 4-[4-[3-(cyclobutylamino)phenyl]-2,6-difluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 87055318 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-[4-[3-(cyclobutylamino)phenyl]-2,6-difluorophenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1c(F)cc(-c2cccc(NC3CCC3)c2)cc1F |
| InChI | InChI=1S/C20H21F2NO3/c21-17-11-14(12-18(22)20(17)26-9-3-8-19(24)25)13-4-1-7-16(10-13)23-15-5-2-6-15/h1,4,7,10-12,15,23H,2-3,5-6,8-9H2,(H,24,25) |
| InChIKey | BZAIEPJJTFZOPW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|