perchloryl hydrogen carbonate

CHClO6 — CID 87058873

IUPACperchloryl hydrogen carbonate
SMILESO=C(O)O[Cl+3]([O-])([O-])[O-]
InChIInChI=1S/CHClO6/c3-1(4)8-2(5,6)7/h(H,3,4)
InChIKeyWUIPETROZGWMAR-UHFFFAOYSA-N
MW144.47 g/mol
LogP-3.42
Rot. Bonds1

About perchloryl hydrogen carbonate

perchloryl hydrogen carbonate (PubChem CID 87058873) has the molecular formula CHClO6 and a molecular weight of 144.47 g/mol. Its IUPAC name is perchloryl hydrogen carbonate.

Molecular Properties

Compound Nameperchloryl hydrogen carbonate
PubChem CID87058873
Molecular FormulaCHClO6
Molecular Weight144.47 g/mol
Exact Mass143.95
IUPAC Nameperchloryl hydrogen carbonate
SMILESO=C(O)O[Cl+3]([O-])([O-])[O-]
InChIInChI=1S/CHClO6/c3-1(4)8-2(5,6)7/h(H,3,4)
InChIKeyWUIPETROZGWMAR-UHFFFAOYSA-N
XLogP-3.42
TPSA115.71 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.47
LogP ≤ 5-3.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze perchloryl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of perchloryl hydrogen carbonate?
The IUPAC name of perchloryl hydrogen carbonate (CID 87058873) is perchloryl hydrogen carbonate.
What is the SMILES notation for perchloryl hydrogen carbonate?
The canonical SMILES for perchloryl hydrogen carbonate is O=C(O)O[Cl+3]([O-])([O-])[O-].
What is the InChIKey of perchloryl hydrogen carbonate?
The InChIKey is WUIPETROZGWMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/CHClO6/c3-1(4)8-2(5,6)7/h(H,3,4).
What are the key properties of perchloryl hydrogen carbonate?
perchloryl hydrogen carbonate has a molecular weight of 144.47 g/mol, XLogP of -3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for perchloryl hydrogen carbonate is sourced from PubChem (CID 87058873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).