C8H19F3NO6S2+ — CID 87059940
trifluoromethanesulfonic acid;trimethyl(4-sulfobutyl)azanium (PubChem CID 87059940) has the molecular formula C8H19F3NO6S2+ and a molecular weight of 346.37 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;trimethyl(4-sulfobutyl)azanium.
| Compound Name | trifluoromethanesulfonic acid;trimethyl(4-sulfobutyl)azanium |
|---|---|
| PubChem CID | 87059940 |
| Molecular Formula | C8H19F3NO6S2+ |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | trifluoromethanesulfonic acid;trimethyl(4-sulfobutyl)azanium |
| SMILES | C[N+](C)(C)CCCCS(=O)(=O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C7H17NO3S.CHF3O3S/c1-8(2,3)6-4-5-7-12(9,10)11;2-1(3,4)8(5,6)7/h4-7H2,1-3H3;(H,5,6,7)/p+1 |
| InChIKey | OYIWBLODZXUUKY-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|