About 2-ethyl-1,1-dioctylhydrazine
2-ethyl-1,1-dioctylhydrazine (PubChem CID 87060766) has the molecular formula C18H40N2
and a molecular weight of 284.53 g/mol. Its IUPAC name is 2-ethyl-1,1-dioctylhydrazine.
Molecular Properties
| Compound Name | 2-ethyl-1,1-dioctylhydrazine |
| PubChem CID | 87060766 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | 2-ethyl-1,1-dioctylhydrazine |
| SMILES | CCCCCCCCN(CCCCCCCC)NCC |
| InChI | InChI=1S/C18H40N2/c1-4-7-9-11-13-15-17-20(19-6-3)18-16-14-12-10-8-5-2/h19H,4-18H2,1-3H3 |
| InChIKey | YUGDZKLVFDSZGW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,1-dioctylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,1-dioctylhydrazine?
The IUPAC name of 2-ethyl-1,1-dioctylhydrazine (CID 87060766) is 2-ethyl-1,1-dioctylhydrazine.
What is the SMILES notation for 2-ethyl-1,1-dioctylhydrazine?
The canonical SMILES for 2-ethyl-1,1-dioctylhydrazine is CCCCCCCCN(CCCCCCCC)NCC.
What is the InChIKey of 2-ethyl-1,1-dioctylhydrazine?
The InChIKey is YUGDZKLVFDSZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40N2/c1-4-7-9-11-13-15-17-20(19-6-3)18-16-14-12-10-8-5-2/h19H,4-18H2,1-3H3.
What are the key properties of 2-ethyl-1,1-dioctylhydrazine?
2-ethyl-1,1-dioctylhydrazine has a molecular weight of 284.53 g/mol, XLogP of 5.53, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,1-dioctylhydrazine is sourced from PubChem (CID 87060766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).