C19H16ClN3O3S — CID 8706090
(E)-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-3-(3-hydroxyphenyl)prop-2-enoic acid (PubChem CID 8706090) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is (E)-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-3-(3-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-3-(3-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 8706090 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (E)-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-3-(3-hydroxyphenyl)prop-2-enoic acid |
| SMILES | CCn1c(S/C(=C/c2cccc(O)c2)C(=O)O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3O3S/c1-2-23-17(13-6-8-14(20)9-7-13)21-22-19(23)27-16(18(25)26)11-12-4-3-5-15(24)10-12/h3-11,24H,2H2,1H3,(H,25,26)/b16-11+ |
| InChIKey | HBXZZDLNIZZGKT-LFIBNONCSA-N |
| XLogP | 4.54 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|