C19H15ClN3O3S- — CID 54716090
4-[(E)-2-carboxy-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]ethenyl]phenolate (PubChem CID 54716090) has the molecular formula C19H15ClN3O3S- and a molecular weight of 400.87 g/mol. Its IUPAC name is 4-[(E)-2-carboxy-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]ethenyl]phenolate.
| Compound Name | 4-[(E)-2-carboxy-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]ethenyl]phenolate |
|---|---|
| PubChem CID | 54716090 |
| Molecular Formula | C19H15ClN3O3S- |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 4-[(E)-2-carboxy-2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]ethenyl]phenolate |
| SMILES | CCn1c(S/C(=C/c2ccc([O-])cc2)C(=O)O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3O3S/c1-2-23-17(13-5-7-14(20)8-6-13)21-22-19(23)27-16(18(25)26)11-12-3-9-15(24)10-4-12/h3-11,24H,2H2,1H3,(H,25,26)/p-1/b16-11+ |
| InChIKey | BCWXTSMYPDYFMY-LFIBNONCSA-M |
| XLogP | 3.91 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|