C27H57NO3P+ — CID 87062871
1-[hydroxy-[(Z)-icos-9-enoxy]phosphoryl]butyl-trimethylazanium (PubChem CID 87062871) has the molecular formula C27H57NO3P+ and a molecular weight of 474.73 g/mol. Its IUPAC name is 1-[hydroxy-[(Z)-icos-9-enoxy]phosphoryl]butyl-trimethylazanium.
| Compound Name | 1-[hydroxy-[(Z)-icos-9-enoxy]phosphoryl]butyl-trimethylazanium |
|---|---|
| PubChem CID | 87062871 |
| Molecular Formula | C27H57NO3P+ |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | 1-[hydroxy-[(Z)-icos-9-enoxy]phosphoryl]butyl-trimethylazanium |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCCOP(=O)(O)C(CCC)[N+](C)(C)C |
| InChI | InChI=1S/C27H56NO3P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-31-32(29,30)27(25-7-2)28(3,4)5/h16-17,27H,6-15,18-26H2,1-5H3/p+1/b17-16- |
| InChIKey | KGSPHLBUFQFAAI-MSUUIHNZSA-O |
| XLogP | 8.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|