C26H55NO3P+ — CID 90773672
1-[hydroxy(nonadec-9-enoxy)phosphoryl]butyl-trimethylazanium (PubChem CID 90773672) has the molecular formula C26H55NO3P+ and a molecular weight of 460.70 g/mol. Its IUPAC name is 1-[hydroxy(nonadec-9-enoxy)phosphoryl]butyl-trimethylazanium.
| Compound Name | 1-[hydroxy(nonadec-9-enoxy)phosphoryl]butyl-trimethylazanium |
|---|---|
| PubChem CID | 90773672 |
| Molecular Formula | C26H55NO3P+ |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | 1-[hydroxy(nonadec-9-enoxy)phosphoryl]butyl-trimethylazanium |
| SMILES | CCCCCCCCCC=CCCCCCCCCOP(=O)(O)C(CCC)[N+](C)(C)C |
| InChI | InChI=1S/C26H54NO3P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-30-31(28,29)26(24-7-2)27(3,4)5/h15-16,26H,6-14,17-25H2,1-5H3/p+1 |
| InChIKey | DEEZOJNOOODZAL-UHFFFAOYSA-O |
| XLogP | 8.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|