C38H48N4O6 — CID 87064775
N-[2-[[(2S)-2-[hexanoyl(hydroxy)amino]-3-methyl-2-[(2-phenylphenyl)methyl]butanoyl]amino]-3-phenylpropanoyl]morpholine-4-carboxamide (PubChem CID 87064775) has the molecular formula C38H48N4O6 and a molecular weight of 656.82 g/mol. Its IUPAC name is N-[2-[[(2S)-2-[hexanoyl(hydroxy)amino]-3-methyl-2-[(2-phenylphenyl)methyl]butanoyl]amino]-3-phenylpropanoyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[[(2S)-2-[hexanoyl(hydroxy)amino]-3-methyl-2-[(2-phenylphenyl)methyl]butanoyl]amino]-3-phenylpropanoyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 87064775 |
| Molecular Formula | C38H48N4O6 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.36 |
| IUPAC Name | N-[2-[[(2S)-2-[hexanoyl(hydroxy)amino]-3-methyl-2-[(2-phenylphenyl)methyl]butanoyl]amino]-3-phenylpropanoyl]morpholine-4-carboxamide |
| SMILES | CCCCCC(=O)N(O)[C@](Cc1ccccc1-c1ccccc1)(C(=O)NC(Cc1ccccc1)C(=O)NC(=O)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C38H48N4O6/c1-4-5-8-21-34(43)42(47)38(28(2)3,27-31-19-13-14-20-32(31)30-17-11-7-12-18-30)36(45)39-33(26-29-15-9-6-10-16-29)35(44)40-37(46)41-22-24-48-25-23-41/h6-7,9-20,28,33,47H,4-5,8,21-27H2,1-3H3,(H,39,45)(H,40,44,46)/t33?,38-/m0/s1 |
| InChIKey | KOZYPIPIPVRUHH-XGAAXKDISA-N |
| XLogP | 5.38 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|