C18H34N2O3 — CID 87065108
ethyl (E)-4-[[3,3-dimethyl-2-(methylamino)butanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 87065108) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is ethyl (E)-4-[[3,3-dimethyl-2-(methylamino)butanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E)-4-[[3,3-dimethyl-2-(methylamino)butanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 87065108 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | ethyl (E)-4-[[3,3-dimethyl-2-(methylamino)butanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C(C(C)C)N(C)C(=O)C(NC)C(C)(C)C |
| InChI | InChI=1S/C18H34N2O3/c1-10-23-17(22)13(4)11-14(12(2)3)20(9)16(21)15(19-8)18(5,6)7/h11-12,14-15,19H,10H2,1-9H3/b13-11+ |
| InChIKey | MLWFETSSTVPZKL-ACCUITESSA-N |
| XLogP | 2.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|