C29H55NO4 — CID 87066167
6-hydroxy-2-[[(Z)-icos-11-en-2-yl]-dimethylazaniumyl]-2-methyl-6-oxohexanoate (PubChem CID 87066167) has the molecular formula C29H55NO4 and a molecular weight of 481.76 g/mol. Its IUPAC name is 6-hydroxy-2-[[(Z)-icos-11-en-2-yl]-dimethylazaniumyl]-2-methyl-6-oxohexanoate.
| Compound Name | 6-hydroxy-2-[[(Z)-icos-11-en-2-yl]-dimethylazaniumyl]-2-methyl-6-oxohexanoate |
|---|---|
| PubChem CID | 87066167 |
| Molecular Formula | C29H55NO4 |
| Molecular Weight | 481.76 g/mol |
| Exact Mass | 481.41 |
| IUPAC Name | 6-hydroxy-2-[[(Z)-icos-11-en-2-yl]-dimethylazaniumyl]-2-methyl-6-oxohexanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(C)[N+](C)(C)C(C)(CCCC(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C29H55NO4/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(2)30(4,5)29(3,28(33)34)25-22-24-27(31)32/h13-14,26H,6-12,15-25H2,1-5H3,(H-,31,32,33,34)/b14-13- |
| InChIKey | ALFCPCJXKNCMHO-YPKPFQOOSA-N |
| XLogP | 6.64 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.76 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|