C28H54NO4+ — CID 87795145
2,5-dicarboxypentan-2-yl-dimethyl-[(Z)-nonadec-10-enyl]azanium (PubChem CID 87795145) has the molecular formula C28H54NO4+ and a molecular weight of 468.74 g/mol. Its IUPAC name is 2,5-dicarboxypentan-2-yl-dimethyl-[(Z)-nonadec-10-enyl]azanium.
| Compound Name | 2,5-dicarboxypentan-2-yl-dimethyl-[(Z)-nonadec-10-enyl]azanium |
|---|---|
| PubChem CID | 87795145 |
| Molecular Formula | C28H54NO4+ |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | 2,5-dicarboxypentan-2-yl-dimethyl-[(Z)-nonadec-10-enyl]azanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC[N+](C)(C)C(C)(CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H53NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-29(3,4)28(2,27(32)33)24-22-23-26(30)31/h12-13H,5-11,14-25H2,1-4H3,(H-,30,31,32,33)/p+1/b13-12- |
| InChIKey | LZVUEKRMULGXTE-SEYXRHQNSA-O |
| XLogP | 7.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|