C25H25N5O2 — CID 87068206
2-[4-[2-(6-methoxy-3-pyridinyl)phenyl]piperazin-1-yl]-2-pyrrolo[2,3-b]pyridin-1-ylacetaldehyde (PubChem CID 87068206) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-[4-[2-(6-methoxy-3-pyridinyl)phenyl]piperazin-1-yl]-2-pyrrolo[2,3-b]pyridin-1-ylacetaldehyde.
| Compound Name | 2-[4-[2-(6-methoxy-3-pyridinyl)phenyl]piperazin-1-yl]-2-pyrrolo[2,3-b]pyridin-1-ylacetaldehyde |
|---|---|
| PubChem CID | 87068206 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[4-[2-(6-methoxy-3-pyridinyl)phenyl]piperazin-1-yl]-2-pyrrolo[2,3-b]pyridin-1-ylacetaldehyde |
| SMILES | COc1ccc(-c2ccccc2N2CCN(C(C=O)n3ccc4cccnc43)CC2)cn1 |
| InChI | InChI=1S/C25H25N5O2/c1-32-23-9-8-20(17-27-23)21-6-2-3-7-22(21)28-13-15-29(16-14-28)24(18-31)30-12-10-19-5-4-11-26-25(19)30/h2-12,17-18,24H,13-16H2,1H3 |
| InChIKey | HEKDORDJZDZDFT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|