C29H35BrN4O2 — CID 90185990
N-[(6-bromo-3-pyridinyl)methyl]-6-[4-[2-(4-methoxyphenyl)phenyl]piperazin-1-yl]hexanamide (PubChem CID 90185990) has the molecular formula C29H35BrN4O2 and a molecular weight of 551.53 g/mol. Its IUPAC name is N-[(6-bromo-3-pyridinyl)methyl]-6-[4-[2-(4-methoxyphenyl)phenyl]piperazin-1-yl]hexanamide.
| Compound Name | N-[(6-bromo-3-pyridinyl)methyl]-6-[4-[2-(4-methoxyphenyl)phenyl]piperazin-1-yl]hexanamide |
|---|---|
| PubChem CID | 90185990 |
| Molecular Formula | C29H35BrN4O2 |
| Molecular Weight | 551.53 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | N-[(6-bromo-3-pyridinyl)methyl]-6-[4-[2-(4-methoxyphenyl)phenyl]piperazin-1-yl]hexanamide |
| SMILES | COc1ccc(-c2ccccc2N2CCN(CCCCCC(=O)NCc3ccc(Br)nc3)CC2)cc1 |
| InChI | InChI=1S/C29H35BrN4O2/c1-36-25-13-11-24(12-14-25)26-7-4-5-8-27(26)34-19-17-33(18-20-34)16-6-2-3-9-29(35)32-22-23-10-15-28(30)31-21-23/h4-5,7-8,10-15,21H,2-3,6,9,16-20,22H2,1H3,(H,32,35) |
| InChIKey | DAOICOSTQPVDDA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|