(1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate

C8H16O5S2 — CID 87069335

IUPAC(1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate
SMILESCCCCCC(O)(O)SSOC(=O)CO
InChIInChI=1S/C8H16O5S2/c1-2-3-4-5-8(11,12)14-15-13-7(10)6-9/h9,11-12H,2-6H2,1H3
InChIKeyQIPZULMFHJIDRL-UHFFFAOYSA-N
MW256.34 g/mol
LogP1.04
Rot. Bonds8

About (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate

(1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate (PubChem CID 87069335) has the molecular formula C8H16O5S2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate.

Molecular Properties

Compound Name(1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate
PubChem CID87069335
Molecular FormulaC8H16O5S2
Molecular Weight256.34 g/mol
Exact Mass256.04
IUPAC Name(1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate
SMILESCCCCCC(O)(O)SSOC(=O)CO
InChIInChI=1S/C8H16O5S2/c1-2-3-4-5-8(11,12)14-15-13-7(10)6-9/h9,11-12H,2-6H2,1H3
InChIKeyQIPZULMFHJIDRL-UHFFFAOYSA-N
XLogP1.04
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.34
LogP ≤ 51.04
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}

Analyze (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate?
The IUPAC name of (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate (CID 87069335) is (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate.
What is the SMILES notation for (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate?
The canonical SMILES for (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate is CCCCCC(O)(O)SSOC(=O)CO.
What is the InChIKey of (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate?
The InChIKey is QIPZULMFHJIDRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O5S2/c1-2-3-4-5-8(11,12)14-15-13-7(10)6-9/h9,11-12H,2-6H2,1H3.
What are the key properties of (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate?
(1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate has a molecular weight of 256.34 g/mol, XLogP of 1.04, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dihydroxyhexyldisulfanyl) 2-hydroxyacetate is sourced from PubChem (CID 87069335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).