C20H15F2N5O2S — CID 87072959
1-cyano-2-[[4-(3,4-difluorophenyl)sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine (PubChem CID 87072959) has the molecular formula C20H15F2N5O2S and a molecular weight of 427.44 g/mol. Its IUPAC name is 1-cyano-2-[[4-(3,4-difluorophenyl)sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[[4-(3,4-difluorophenyl)sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 87072959 |
| Molecular Formula | C20H15F2N5O2S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 1-cyano-2-[[4-(3,4-difluorophenyl)sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\Cc1ccc(S(=O)(=O)c2ccc(F)c(F)c2)cc1)Nc1ccncc1 |
| InChI | InChI=1S/C20H15F2N5O2S/c21-18-6-5-17(11-19(18)22)30(28,29)16-3-1-14(2-4-16)12-25-20(26-13-23)27-15-7-9-24-10-8-15/h1-11H,12H2,(H2,24,25,26,27) |
| InChIKey | YANBKPJDDVRAAF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|