C74H77F5N2O6S2 — CID 87074460
[5-[bis(6-tritylsulfanylhexyl)amino]-1-[4-[ethyl(propyl)carbamoyl]oxyphenyl]-5-oxopentyl] (2,3,4,5,6-pentafluorophenyl) carbonate (PubChem CID 87074460) has the molecular formula C74H77F5N2O6S2 and a molecular weight of 1249.56 g/mol. Its IUPAC name is [5-[bis(6-tritylsulfanylhexyl)amino]-1-[4-[ethyl(propyl)carbamoyl]oxyphenyl]-5-oxopentyl] (2,3,4,5,6-pentafluorophenyl) carbonate.
| Compound Name | [5-[bis(6-tritylsulfanylhexyl)amino]-1-[4-[ethyl(propyl)carbamoyl]oxyphenyl]-5-oxopentyl] (2,3,4,5,6-pentafluorophenyl) carbonate |
|---|---|
| PubChem CID | 87074460 |
| Molecular Formula | C74H77F5N2O6S2 |
| Molecular Weight | 1249.56 g/mol |
| Exact Mass | 1248.51 |
| IUPAC Name | [5-[bis(6-tritylsulfanylhexyl)amino]-1-[4-[ethyl(propyl)carbamoyl]oxyphenyl]-5-oxopentyl] (2,3,4,5,6-pentafluorophenyl) carbonate |
| SMILES | CCCN(CC)C(=O)Oc1ccc(C(CCCC(=O)N(CCCCCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)CCCCCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)OC(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C74H77F5N2O6S2/c1-3-50-80(4-2)71(83)85-62-48-46-55(47-49-62)63(86-72(84)87-70-68(78)66(76)65(75)67(77)69(70)79)44-31-45-64(82)81(51-27-5-7-29-53-88-73(56-32-15-9-16-33-56,57-34-17-10-18-35-57)58-36-19-11-20-37-58)52-28-6-8-30-54-89-74(59-38-21-12-22-39-59,60-40-23-13-24-41-60)61-42-25-14-26-43-61/h9-26,32-43,46-49,63H,3-8,27-31,44-45,50-54H2,1-2H3 |
| InChIKey | SLYHPCQKXADBSJ-UHFFFAOYSA-N |
| XLogP | 19.44 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1249.56 |
| LogP ≤ 5 | 19.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|