C24H25F5O5 — CID 139851663
methyl 4-[4-[(1S)-5,5,6,6,6-pentafluoro-1-phenoxycarbonyloxyhexyl]phenyl]butanoate (PubChem CID 139851663) has the molecular formula C24H25F5O5 and a molecular weight of 488.45 g/mol. Its IUPAC name is methyl 4-[4-[(1S)-5,5,6,6,6-pentafluoro-1-phenoxycarbonyloxyhexyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[(1S)-5,5,6,6,6-pentafluoro-1-phenoxycarbonyloxyhexyl]phenyl]butanoate |
|---|---|
| PubChem CID | 139851663 |
| Molecular Formula | C24H25F5O5 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | methyl 4-[4-[(1S)-5,5,6,6,6-pentafluoro-1-phenoxycarbonyloxyhexyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc([C@H](CCCC(F)(F)C(F)(F)F)OC(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25F5O5/c1-32-21(30)11-5-7-17-12-14-18(15-13-17)20(10-6-16-23(25,26)24(27,28)29)34-22(31)33-19-8-3-2-4-9-19/h2-4,8-9,12-15,20H,5-7,10-11,16H2,1H3/t20-/m0/s1 |
| InChIKey | SQOXRTRHNRWAHB-FQEVSTJZSA-N |
| XLogP | 6.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|