C20H30N2O6S — CID 8707727
ethyl 1-[2-[2-methyl-4-(propylsulfamoyl)phenoxy]acetyl]piperidine-4-carboxylate (PubChem CID 8707727) has the molecular formula C20H30N2O6S and a molecular weight of 426.54 g/mol. Its IUPAC name is ethyl 1-[2-[2-methyl-4-(propylsulfamoyl)phenoxy]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-methyl-4-(propylsulfamoyl)phenoxy]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8707727 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | ethyl 1-[2-[2-methyl-4-(propylsulfamoyl)phenoxy]acetyl]piperidine-4-carboxylate |
| SMILES | CCCNS(=O)(=O)c1ccc(OCC(=O)N2CCC(C(=O)OCC)CC2)c(C)c1 |
| InChI | InChI=1S/C20H30N2O6S/c1-4-10-21-29(25,26)17-6-7-18(15(3)13-17)28-14-19(23)22-11-8-16(9-12-22)20(24)27-5-2/h6-7,13,16,21H,4-5,8-12,14H2,1-3H3 |
| InChIKey | BXLUZXWCPPOVPB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |