C21H42N4 — CID 87082374
1-N',1-N",2-N-tricyclohexylpropane-1,1,1,2-tetramine (PubChem CID 87082374) has the molecular formula C21H42N4 and a molecular weight of 350.60 g/mol. Its IUPAC name is 1-N',1-N",2-N-tricyclohexylpropane-1,1,1,2-tetramine.
| Compound Name | 1-N',1-N",2-N-tricyclohexylpropane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 87082374 |
| Molecular Formula | C21H42N4 |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 350.34 |
| IUPAC Name | 1-N',1-N",2-N-tricyclohexylpropane-1,1,1,2-tetramine |
| SMILES | CC(NC1CCCCC1)C(N)(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C21H42N4/c1-17(23-18-11-5-2-6-12-18)21(22,24-19-13-7-3-8-14-19)25-20-15-9-4-10-16-20/h17-20,23-25H,2-16,22H2,1H3 |
| InChIKey | JDLXRZLYWIGQNY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|