C21H44N4Si — CID 173002311
1-N,1-N',2-N-tricyclohexyl-1-N"-silylpropane-1,1,1,2-tetramine (PubChem CID 173002311) has the molecular formula C21H44N4Si and a molecular weight of 380.70 g/mol. Its IUPAC name is 1-N,1-N',2-N-tricyclohexyl-1-N"-silylpropane-1,1,1,2-tetramine.
| Compound Name | 1-N,1-N',2-N-tricyclohexyl-1-N"-silylpropane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 173002311 |
| Molecular Formula | C21H44N4Si |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | 1-N,1-N',2-N-tricyclohexyl-1-N"-silylpropane-1,1,1,2-tetramine |
| SMILES | CC(NC1CCCCC1)C(N[SiH3])(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C21H44N4Si/c1-17(22-18-11-5-2-6-12-18)21(25-26,23-19-13-7-3-8-14-19)24-20-15-9-4-10-16-20/h17-20,22-25H,2-16H2,1,26H3 |
| InChIKey | GOTRPQICYHQKCR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|