C11H11F3N2O3 — CID 87083994
1-[4-[(Z)-N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl]ethylcarbamic acid (PubChem CID 87083994) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is 1-[4-[(Z)-N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl]ethylcarbamic acid.
| Compound Name | 1-[4-[(Z)-N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 87083994 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-[4-[(Z)-N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl]ethylcarbamic acid |
| SMILES | CC(NC(=O)O)c1ccc(/C(=N/O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3N2O3/c1-6(15-10(17)18)7-2-4-8(5-3-7)9(16-19)11(12,13)14/h2-6,15,19H,1H3,(H,17,18)/b16-9- |
| InChIKey | XVDLYBJVBCIULW-SXGWCWSVSA-N |
| XLogP | 2.76 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|