C20H13F3IN7O — CID 87085208
7-(2,2-difluoroethyl)-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-6-iodo-9H-purin-8-one (PubChem CID 87085208) has the molecular formula C20H13F3IN7O and a molecular weight of 551.27 g/mol. Its IUPAC name is 7-(2,2-difluoroethyl)-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-6-iodo-9H-purin-8-one.
| Compound Name | 7-(2,2-difluoroethyl)-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-6-iodo-9H-purin-8-one |
|---|---|
| PubChem CID | 87085208 |
| Molecular Formula | C20H13F3IN7O |
| Molecular Weight | 551.27 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | 7-(2,2-difluoroethyl)-2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-6-iodo-9H-purin-8-one |
| SMILES | O=c1[nH]c2nc(-c3nn(Cc4ccccc4F)c4ncccc34)nc(I)c2n1CC(F)F |
| InChI | InChI=1S/C20H13F3IN7O/c21-12-6-2-1-4-10(12)8-31-19-11(5-3-7-25-19)14(29-31)17-26-16(24)15-18(27-17)28-20(32)30(15)9-13(22)23/h1-7,13H,8-9H2,(H,26,27,28,32) |
| InChIKey | YXOGPIKSCXTZTL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|