About (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate
(3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate (PubChem CID 87090974) has the molecular formula C5H5F3O6
and a molecular weight of 218.08 g/mol. Its IUPAC name is (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate.
Analyze (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate?
The IUPAC name of (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate (CID 87090974) is (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate.
What is the SMILES notation for (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate?
The canonical SMILES for (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate is O=C(O)OCC(OC(=O)O)C(F)(F)F.
What is the InChIKey of (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate?
The InChIKey is OPKGUOMSJTZDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3O6/c6-5(7,8)2(14-4(11)12)1-13-3(9)10/h2H,1H2,(H,9,10)(H,11,12).
What are the key properties of (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate?
(3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate has a molecular weight of 218.08 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carboxyoxy-1,1,1-trifluoropropan-2-yl) hydrogen carbonate is sourced from PubChem (CID 87090974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).