About 2-fluorobutyl hydrogen carbonate
2-fluorobutyl hydrogen carbonate (PubChem CID 87127877) has the molecular formula C5H9FO3
and a molecular weight of 136.12 g/mol. Its IUPAC name is 2-fluorobutyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-fluorobutyl hydrogen carbonate |
| PubChem CID | 87127877 |
| Molecular Formula | C5H9FO3 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 2-fluorobutyl hydrogen carbonate |
| SMILES | CCC(F)COC(=O)O |
| InChI | InChI=1S/C5H9FO3/c1-2-4(6)3-9-5(7)8/h4H,2-3H2,1H3,(H,7,8) |
| InChIKey | YCFMATXINRTPOR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluorobutyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobutyl hydrogen carbonate?
The IUPAC name of 2-fluorobutyl hydrogen carbonate (CID 87127877) is 2-fluorobutyl hydrogen carbonate.
What is the SMILES notation for 2-fluorobutyl hydrogen carbonate?
The canonical SMILES for 2-fluorobutyl hydrogen carbonate is CCC(F)COC(=O)O.
What is the InChIKey of 2-fluorobutyl hydrogen carbonate?
The InChIKey is YCFMATXINRTPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FO3/c1-2-4(6)3-9-5(7)8/h4H,2-3H2,1H3,(H,7,8).
What are the key properties of 2-fluorobutyl hydrogen carbonate?
2-fluorobutyl hydrogen carbonate has a molecular weight of 136.12 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobutyl hydrogen carbonate is sourced from PubChem (CID 87127877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).