C6H11F2NO2 — CID 82006448
2-(2,2-difluoroethoxy)butanamide (PubChem CID 82006448) has the molecular formula C6H11F2NO2 and a molecular weight of 167.15 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)butanamide.
| Compound Name | 2-(2,2-difluoroethoxy)butanamide |
|---|---|
| PubChem CID | 82006448 |
| Molecular Formula | C6H11F2NO2 |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2-(2,2-difluoroethoxy)butanamide |
| SMILES | CCC(OCC(F)F)C(N)=O |
| InChI | InChI=1S/C6H11F2NO2/c1-2-4(6(9)10)11-3-5(7)8/h4-5H,2-3H2,1H3,(H2,9,10) |
| InChIKey | HODPVUHESWTYIX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |