C6H12F2N2O3 — CID 103229391
2-(2,2-difluoroethoxy)-3-methoxypropanehydrazide (PubChem CID 103229391) has the molecular formula C6H12F2N2O3 and a molecular weight of 198.17 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-3-methoxypropanehydrazide.
| Compound Name | 2-(2,2-difluoroethoxy)-3-methoxypropanehydrazide |
|---|---|
| PubChem CID | 103229391 |
| Molecular Formula | C6H12F2N2O3 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-3-methoxypropanehydrazide |
| SMILES | COCC(OCC(F)F)C(=O)NN |
| InChI | InChI=1S/C6H12F2N2O3/c1-12-2-4(6(11)10-9)13-3-5(7)8/h4-5H,2-3,9H2,1H3,(H,10,11) |
| InChIKey | JLAZULJETQELSR-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|