C5H9F2NOS — CID 82003964
2-(2,2-difluoroethoxy)propanethioamide (PubChem CID 82003964) has the molecular formula C5H9F2NOS and a molecular weight of 169.20 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)propanethioamide.
| Compound Name | 2-(2,2-difluoroethoxy)propanethioamide |
|---|---|
| PubChem CID | 82003964 |
| Molecular Formula | C5H9F2NOS |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 2-(2,2-difluoroethoxy)propanethioamide |
| SMILES | CC(OCC(F)F)C(N)=S |
| InChI | InChI=1S/C5H9F2NOS/c1-3(5(8)10)9-2-4(6)7/h3-4H,2H2,1H3,(H2,8,10) |
| InChIKey | HHJKFVPKUVCRLE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|