About 2-fluorobutyl 2-methoxypropanoate
2-fluorobutyl 2-methoxypropanoate (PubChem CID 88537574) has the molecular formula C8H15FO3
and a molecular weight of 178.20 g/mol. Its IUPAC name is 2-fluorobutyl 2-methoxypropanoate.
Molecular Properties
| Compound Name | 2-fluorobutyl 2-methoxypropanoate |
| PubChem CID | 88537574 |
| Molecular Formula | C8H15FO3 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-fluorobutyl 2-methoxypropanoate |
| SMILES | CCC(F)COC(=O)C(C)OC |
| InChI | InChI=1S/C8H15FO3/c1-4-7(9)5-12-8(10)6(2)11-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | ABFGKERMTWZCLE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluorobutyl 2-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobutyl 2-methoxypropanoate?
The IUPAC name of 2-fluorobutyl 2-methoxypropanoate (CID 88537574) is 2-fluorobutyl 2-methoxypropanoate.
What is the SMILES notation for 2-fluorobutyl 2-methoxypropanoate?
The canonical SMILES for 2-fluorobutyl 2-methoxypropanoate is CCC(F)COC(=O)C(C)OC.
What is the InChIKey of 2-fluorobutyl 2-methoxypropanoate?
The InChIKey is ABFGKERMTWZCLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO3/c1-4-7(9)5-12-8(10)6(2)11-3/h6-7H,4-5H2,1-3H3.
What are the key properties of 2-fluorobutyl 2-methoxypropanoate?
2-fluorobutyl 2-methoxypropanoate has a molecular weight of 178.20 g/mol, XLogP of 1.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobutyl 2-methoxypropanoate is sourced from PubChem (CID 88537574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).