C23H19NO5 — CID 87094067
2-benzhydryl-2-(2-formylanilino)propanedioic acid (PubChem CID 87094067) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-benzhydryl-2-(2-formylanilino)propanedioic acid.
| Compound Name | 2-benzhydryl-2-(2-formylanilino)propanedioic acid |
|---|---|
| PubChem CID | 87094067 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-benzhydryl-2-(2-formylanilino)propanedioic acid |
| SMILES | O=Cc1ccccc1NC(C(=O)O)(C(=O)O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19NO5/c25-15-18-13-7-8-14-19(18)24-23(21(26)27,22(28)29)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15,20,24H,(H,26,27)(H,28,29) |
| InChIKey | VCLUCFNIPOTYAK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|