C23H21F3N4O3 — CID 87094591
N-hydroxy-7-[[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 87094591) has the molecular formula C23H21F3N4O3 and a molecular weight of 458.44 g/mol. Its IUPAC name is N-hydroxy-7-[[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-hydroxy-7-[[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 87094591 |
| Molecular Formula | C23H21F3N4O3 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-hydroxy-7-[[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | Cn1cc(-c2cc(C(=O)Nc3ccc4c(c3)CC(C(=O)NO)CC4)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C23H21F3N4O3/c1-30-12-18(11-27-30)15-7-17(9-19(8-15)23(24,25)26)21(31)28-20-5-4-13-2-3-14(22(32)29-33)6-16(13)10-20/h4-5,7-12,14,33H,2-3,6H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | BMGCORMSZPUFOU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|