C24H20F3N5O3 — CID 88883095
N-hydroxy-2,8-dimethyl-6-[[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)benzoyl]amino]quinoline-3-carboxamide (PubChem CID 88883095) has the molecular formula C24H20F3N5O3 and a molecular weight of 483.45 g/mol. Its IUPAC name is N-hydroxy-2,8-dimethyl-6-[[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)benzoyl]amino]quinoline-3-carboxamide.
| Compound Name | N-hydroxy-2,8-dimethyl-6-[[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)benzoyl]amino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 88883095 |
| Molecular Formula | C24H20F3N5O3 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-hydroxy-2,8-dimethyl-6-[[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)benzoyl]amino]quinoline-3-carboxamide |
| SMILES | Cc1nc2c(C)cc(NC(=O)c3cc(-c4cnn(C)c4)cc(C(F)(F)F)c3)cc2cc1C(=O)NO |
| InChI | InChI=1S/C24H20F3N5O3/c1-12-4-19(8-15-9-20(23(34)31-35)13(2)29-21(12)15)30-22(33)16-5-14(17-10-28-32(3)11-17)6-18(7-16)24(25,26)27/h4-11,35H,1-3H3,(H,30,33)(H,31,34) |
| InChIKey | GVXYMBNDUBLIFD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|