C14H24O6 — CID 87095016
prop-2-enoxymethyl 4-(2-ethoxy-2-methoxyethoxy)-2-methylidenebutanoate (PubChem CID 87095016) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is prop-2-enoxymethyl 4-(2-ethoxy-2-methoxyethoxy)-2-methylidenebutanoate.
| Compound Name | prop-2-enoxymethyl 4-(2-ethoxy-2-methoxyethoxy)-2-methylidenebutanoate |
|---|---|
| PubChem CID | 87095016 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | prop-2-enoxymethyl 4-(2-ethoxy-2-methoxyethoxy)-2-methylidenebutanoate |
| SMILES | C=CCOCOC(=O)C(=C)CCOCC(OC)OCC |
| InChI | InChI=1S/C14H24O6/c1-5-8-18-11-20-14(15)12(3)7-9-17-10-13(16-4)19-6-2/h5,13H,1,3,6-11H2,2,4H3 |
| InChIKey | SKSIERIIWCUZLE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|