C11H21NO — CID 87095726
2-[methyl(octa-4,6-dienyl)amino]ethanol (PubChem CID 87095726) has the molecular formula C11H21NO and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-[methyl(octa-4,6-dienyl)amino]ethanol.
| Compound Name | 2-[methyl(octa-4,6-dienyl)amino]ethanol |
|---|---|
| PubChem CID | 87095726 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-[methyl(octa-4,6-dienyl)amino]ethanol |
| SMILES | CC=CC=CCCCN(C)CCO |
| InChI | InChI=1S/C11H21NO/c1-3-4-5-6-7-8-9-12(2)10-11-13/h3-6,13H,7-11H2,1-2H3 |
| InChIKey | KBYLBOOACIWWBK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|